- such as InI6(InIIICl6)Cl3, InI5(InIIIBr4)2(InIIIBr6), and InIInIIIBr4.
Organoindium compounds feature In–C bonds. Most are In(III) derivatives, but...
-
Organoindium chemistry is the
chemistry of
compounds containing In-C bonds. The main
application of
organoindium chemistry is in the
preparation of semiconducting...
- Cyclopentadienylindium(I), C5H5In, is an
organoindium compound containing indium in the +1
oxidation state.
Commonly abbreviated to CpIn, it is a cyclopentadienyl...
- Trimethylindium,
often abbreviated to TMI or TMIn, is the
organoindium compound with the
formula In(CH3)3. It is a colorless,
pyrophoric solid. Unlike...
-
Organoindium(I)
compounds [In(C5H5)]...
-
gallium and hydrogen.
Organogallium compounds are of
similar reactivity to
organoindium compounds, less
reactive than
organoaluminium compounds, but more reactive...
-
organothallium compounds can be
inferred from that of
organogallium and
organoindium compounds. Organothallium(III)
compounds are more
numerous than organothallium(I)...
-
Organoindium(I)
compounds [In(C5H5)]...
-
Organoindium(I)
compounds [In(C5H5)]...
-
organopalladium chemistry,
organosilver chemistry,
organocadmium chemistry,
organoindium chemistry,
organotin chemistry,
organoantimony chemistry, organotellurium...