- 0 0 0 0 0 0 0 0 1 0 0 0 0 0 ) , {\displaystyle iH=\left({\begin{array}{
ccccc}0&0&0&0&0\\0&0&0&0&0\\0&0&0&0&0\\0&0&0&0&1\\0&0&0&0&0\\\end{array}}\right)...
- /aŋksts/. This
gives an
English syllable the
following structure, (CCC)V(
CCCCC),
where C
represents a
consonant and V a vowel; the word
strengths /strɛŋkθs/...
-
related to this article: Von dem
christenlichen streyt geschehen jm. M.
CCCCC.vj. Jar zu Lißbona ein
haubt stat in
Portigal zwischen den
christen vnd...
- \left({\begin{array}{
ccccc}1&0&0&0&0\\77&1&0&0&0\\12&0&1&0&0\\63&0&0&1&0\\7&0&0&0&1\end{array}}\right)\left({\begin{array}{
ccccc}1&0&0&0&0\\0&1&0&0&0...
- S_{1}=q\;
ccccc\;r\;ddd\;s\;bbbb\;t\;eee\;u} and S 2 = v d d d w b b b b x e e e y c c c c c z {\displaystyle S_{2}=v\;ddd\;w\;bbbb\;x\;eee\;y\;
ccccc\;z} have...
- {
ccccc() { ddddd() { // do
something now } } } } } You can
break up the
functionality like this: doSomething() { // do
something now } CC() {
ccccc()...
-
directly in
front of the king
which is
signed and
dated "Brvegel. FE. M.
CCCCC.LXIII" (where
Bruegel FE. is
short for "Bruegel a fait en",
French for "[painted]...
-
model (JSmol)
Interactive image SMILES CCCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NN=N[N-]3)C(C(C)C)C(=O)[O-].
CCCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NN=N[...
- 0 2 a 4 a 5 0 0 0 1 a 6 0 0 0 0 0 ] {\displaystyle \left[{\begin{array}{
ccccc}1&a_{0}&a_{1}&a_{2}&a_{3}\\0&0&2&a_{4}&a_{5}\\0&0&0&1&a_{6}\\0&0&0&0&0\end{array}}\right]}...
-
acoustic combination (a note and its fifth) counts, the
lowest note is C−2 (or
CCCCC),
which is 4 Hz. In
terms of
recording and reproduction, many
speakers have...
